* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 0198 |
English Synonyms: | RARECHEM AL BM 0198 |
MDL Number.: | MFCD06207078 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C/C(=C\c1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)/C(=O)O |
InChi: | InChI=1S/C18H26O3/c1-11(16(20)21)8-12-9-13(17(2,3)4)15(19)14(10-12)18(5,6)7/h8-10,19H,1-7H3,(H,20,21)/b11-8+ |
InChiKey: | InChIKey=KDOKMHHKUDUTNJ-DHZHZOJOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.