* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 0254 |
English Synonyms: | RARECHEM AL BM 0254 |
MDL Number.: | MFCD06207122 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C/C(=C\c1ccc(cc1)OCC(=O)O)/C(=O)O |
InChi: | InChI=1S/C12H12O5/c1-8(12(15)16)6-9-2-4-10(5-3-9)17-7-11(13)14/h2-6H,7H2,1H3,(H,13,14)(H,15,16)/b8-6+ |
InChiKey: | InChIKey=QWALKDIXLQZMPE-SOFGYWHQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.