* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 0319 |
| English Synonyms: | RARECHEM AL BM 0319 |
| MDL Number.: | MFCD06207174 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C/C(=C\c1ccc(cc1F)C(F)(F)F)/C(=O)O |
| InChi: | InChI=1S/C11H8F4O2/c1-6(10(16)17)4-7-2-3-8(5-9(7)12)11(13,14)15/h2-5H,1H3,(H,16,17)/b6-4+ |
| InChiKey: | InChIKey=FNYWGQXTGWURMB-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.