* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 1091 |
| English Synonyms: | RARECHEM AL BM 1091 |
| MDL Number.: | MFCD06207686 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C/C(=C\c1cn(c2c1cccc2)CC(=O)O)/C(=O)O |
| InChi: | InChI=1S/C14H13NO4/c1-9(14(18)19)6-10-7-15(8-13(16)17)12-5-3-2-4-11(10)12/h2-7H,8H2,1H3,(H,16,17)(H,18,19)/b9-6+ |
| InChiKey: | InChIKey=KOHVHQQZLLTQDW-RMKNXTFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.