* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1093 |
English Synonyms: | RARECHEM AL BM 1093 |
MDL Number.: | MFCD06207688 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C/C(=C\c1cc(ccc1N2CCCC2)[N+](=O)[O-])/C(=O)O |
InChi: | InChI=1S/C14H16N2O4/c1-10(14(17)18)8-11-9-12(16(19)20)4-5-13(11)15-6-2-3-7-15/h4-5,8-9H,2-3,6-7H2,1H3,(H,17,18)/b10-8+ |
InChiKey: | InChIKey=BQEHNDNQSAHLFS-CSKARUKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.