* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1099 |
English Synonyms: | RARECHEM AL BM 1099 |
MDL Number.: | MFCD06207693 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C/C(=C\c1cocc(c1=O)c2ccccc2)/C(=O)O |
InChi: | InChI=1S/C15H12O4/c1-10(15(17)18)7-12-8-19-9-13(14(12)16)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,18)/b10-7+ |
InChiKey: | InChIKey=JLMIOIRKQBFRBH-JXMROGBWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.