* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 1124 |
| English Synonyms: | RARECHEM AL BM 1124 |
| MDL Number.: | MFCD06207711 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C/C(=C\c1ccc(o1)c2c(cc(cc2Cl)C(F)(F)F)Cl)/C(=O)O |
| InChi: | InChI=1S/C15H9Cl2F3O3/c1-7(14(21)22)4-9-2-3-12(23-9)13-10(16)5-8(6-11(13)17)15(18,19)20/h2-6H,1H3,(H,21,22)/b7-4+ |
| InChiKey: | InChIKey=BWMMSGJQOPEHBL-QPJJXVBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.