* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 1154 |
| English Synonyms: | RARECHEM AL BM 1154 |
| MDL Number.: | MFCD06207734 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C/C(=C\c1ccc2c(c1)cc(o2)C(=O)c3ccc(cc3)OC)/C(=O)O |
| InChi: | InChI=1S/C20H16O5/c1-12(20(22)23)9-13-3-8-17-15(10-13)11-18(25-17)19(21)14-4-6-16(24-2)7-5-14/h3-11H,1-2H3,(H,22,23)/b12-9+ |
| InChiKey: | InChIKey=BKVBJTPQOWBEMI-FMIVXFBMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.