* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 1178 |
| English Synonyms: | RARECHEM AL BM 1178 |
| MDL Number.: | MFCD06207756 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cc(ccc1N(C)C)/C=C(\C)/C(=O)O |
| InChi: | InChI=1S/C13H17NO2/c1-9-7-11(8-10(2)13(15)16)5-6-12(9)14(3)4/h5-8H,1-4H3,(H,15,16)/b10-8+ |
| InChiKey: | InChIKey=UAMUUKJMNFXFKX-CSKARUKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.