* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 1183 |
| English Synonyms: | RARECHEM AL BM 1183 |
| MDL Number.: | MFCD06207760 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | C/C(=C\c1cc(ccc1N2CCC(CC2)c3ccccc3OC)[N+](=O)[O-])/C(=O)O |
| InChi: | InChI=1S/C22H24N2O5/c1-15(22(25)26)13-17-14-18(24(27)28)7-8-20(17)23-11-9-16(10-12-23)19-5-3-4-6-21(19)29-2/h3-8,13-14,16H,9-12H2,1-2H3,(H,25,26)/b15-13+ |
| InChiKey: | InChIKey=CZCFRVUOLSGDCC-FYWRMAATSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.