* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1213 |
English Synonyms: | RARECHEM AL BM 1213 |
MDL Number.: | MFCD06207786 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C/C(=C\c1ccc(cc1)OCCCN2C(=O)c3ccccc3C2=O)/C(=O)O |
InChi: | InChI=1S/C21H19NO5/c1-14(21(25)26)13-15-7-9-16(10-8-15)27-12-4-11-22-19(23)17-5-2-3-6-18(17)20(22)24/h2-3,5-10,13H,4,11-12H2,1H3,(H,25,26)/b14-13+ |
InChiKey: | InChIKey=JYSZPISFQHLBQT-BUHFOSPRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.