* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1220 |
English Synonyms: | RARECHEM AL BM 1220 |
MDL Number.: | MFCD06207792 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C/C(=C\c1ccc(c(c1)OC)OC(=O)c2ccc(c(c2)Cl)Cl)/C(=O)O |
InChi: | InChI=1S/C18H14Cl2O5/c1-10(17(21)22)7-11-3-6-15(16(8-11)24-2)25-18(23)12-4-5-13(19)14(20)9-12/h3-9H,1-2H3,(H,21,22)/b10-7+ |
InChiKey: | InChIKey=GZUHOSRDRYARCS-JXMROGBWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.