* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1236 |
English Synonyms: | RARECHEM AL BM 1236 |
MDL Number.: | MFCD06207808 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C(=C\c1ccccc1c2ccc(cc2)C(F)(F)F)/C(=O)O |
InChi: | InChI=1S/C17H13F3O2/c1-11(16(21)22)10-13-4-2-3-5-15(13)12-6-8-14(9-7-12)17(18,19)20/h2-10H,1H3,(H,21,22)/b11-10+ |
InChiKey: | InChIKey=VGMDZOMBAMSJTA-ZHACJKMWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.