* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1260 |
English Synonyms: | RARECHEM AL BM 1260 |
MDL Number.: | MFCD06207823 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C/C(=C\c1ccc(cc1)n2c(cc(n2)C(C)(C)C)C(C)(C)C)/C(=O)O |
InChi: | InChI=1S/C21H28N2O2/c1-14(19(24)25)12-15-8-10-16(11-9-15)23-18(21(5,6)7)13-17(22-23)20(2,3)4/h8-13H,1-7H3,(H,24,25)/b14-12+ |
InChiKey: | InChIKey=PHOPABOCNDPWGR-WYMLVPIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.