* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1267 |
English Synonyms: | RARECHEM AL BM 1267 |
MDL Number.: | MFCD06207830 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C/C(=C\c1cccn1CCC#N)/C(=O)O |
InChi: | InChI=1S/C11H12N2O2/c1-9(11(14)15)8-10-4-2-6-13(10)7-3-5-12/h2,4,6,8H,3,7H2,1H3,(H,14,15)/b9-8+ |
InChiKey: | InChIKey=KYGUSNGUBYUHDM-CMDGGOBGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.