* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1306 |
English Synonyms: | RARECHEM AL BM 1306 |
MDL Number.: | MFCD06207864 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C(=C\c1c(cc(cc1F)Br)F)/C(=O)O |
InChi: | InChI=1S/C10H7BrF2O2/c1-5(10(14)15)2-7-8(12)3-6(11)4-9(7)13/h2-4H,1H3,(H,14,15)/b5-2+ |
InChiKey: | InChIKey=NWDJCBXVTSQWRA-GORDUTHDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.