* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 1318 |
English Synonyms: | RARECHEM AL BM 1318 |
MDL Number.: | MFCD06207876 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C/C(=C\c1csc(n1)c2ccccc2)/C(=O)O |
InChi: | InChI=1S/C13H11NO2S/c1-9(13(15)16)7-11-8-17-12(14-11)10-5-3-2-4-6-10/h2-8H,1H3,(H,15,16)/b9-7+ |
InChiKey: | InChIKey=NMNHOGNMPNYWPD-VQHVLOKHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.