* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 1340 |
| English Synonyms: | RARECHEM AL BM 1340 |
| MDL Number.: | MFCD06207893 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C/C(=C\c1ccccc1c2cccc(c2)C(=O)O)/C(=O)O |
| InChi: | InChI=1S/C17H14O4/c1-11(16(18)19)9-12-5-2-3-8-15(12)13-6-4-7-14(10-13)17(20)21/h2-10H,1H3,(H,18,19)(H,20,21)/b11-9+ |
| InChiKey: | InChIKey=RJWPAMUXVJHFGM-PKNBQFBNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.