* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BO 1429 |
| English Synonyms: | RARECHEM AL BO 1429 |
| MDL Number.: | MFCD06208403 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1c(nc(s1)N=C(N)N)CSCCC(=O)O |
| InChi: | InChI=1S/C8H12N4O2S2/c9-7(10)12-8-11-5(4-16-8)3-15-2-1-6(13)14/h4H,1-3H2,(H,13,14)(H4,9,10,11,12) |
| InChiKey: | InChIKey=JEGZXDCDUSGFSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.