* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1431 |
English Synonyms: | RARECHEM AL BO 1431 |
MDL Number.: | MFCD06208405 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(c(c1)C[Zn][BrH](=O)O)C(=O)O |
InChi: | InChI=1S/C8H7O2.BrH2O2.Zn/c1-6-4-2-3-5-7(6)8(9)10;2-1-3;/h2-5H,1H2,(H,9,10);1H,(H,2,3); |
InChiKey: | InChIKey=BFFNQBJGJZIYRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.