* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1433 |
English Synonyms: | RARECHEM AL BO 1433 |
MDL Number.: | MFCD06208407 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(ccc1C[Zn]Br)C(=O)O |
InChi: | InChI=1S/C8H7O2.BrH.Zn/c1-6-2-4-7(5-3-6)8(9)10;;/h2-5H,1H2,(H,9,10);1H;/q;;+1/p-1 |
InChiKey: | InChIKey=XWGZSCHHHMMFEX-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.