* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1490 |
English Synonyms: | RARECHEM AL BO 1490 |
MDL Number.: | MFCD06208423 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCCCC(CC)COc1cc(c(cc1CC(=O)O)OC)CC(=O)O |
InChi: | InChI=1S/C19H28O6/c1-4-6-7-13(5-2)12-25-17-9-14(10-18(20)21)16(24-3)8-15(17)11-19(22)23/h8-9,13H,4-7,10-12H2,1-3H3,(H,20,21)(H,22,23) |
InChiKey: | InChIKey=BSXHQTKOLKVPDF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.