* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BO 1491 |
| English Synonyms: | RARECHEM AL BO 1491 |
| MDL Number.: | MFCD06208424 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)CCCC(C)CCOc1cc(c(cc1CC(=O)O)OC)CC(=O)O |
| InChi: | InChI=1S/C21H32O6/c1-14(2)6-5-7-15(3)8-9-27-19-11-16(12-20(22)23)18(26-4)10-17(19)13-21(24)25/h10-11,14-15H,5-9,12-13H2,1-4H3,(H,22,23)(H,24,25) |
| InChiKey: | InChIKey=HJPJOTFZRMGPNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.