* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1493 |
English Synonyms: | RARECHEM AL BO 1493 |
MDL Number.: | MFCD06208426 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCCCCCCCOc1cc(c(cc1CC(=O)O)OCCCCCCCC)CC(=O)O |
InChi: | InChI=1S/C26H42O6/c1-3-5-7-9-11-13-15-31-23-17-22(20-26(29)30)24(18-21(23)19-25(27)28)32-16-14-12-10-8-6-4-2/h17-18H,3-16,19-20H2,1-2H3,(H,27,28)(H,29,30) |
InChiKey: | InChIKey=BENSFNZNFKCGJX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.