* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1494 |
English Synonyms: | RARECHEM AL BO 1494 |
MDL Number.: | MFCD06208427 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(ccc1CC(=O)O)N=C=O |
InChi: | InChI=1S/C9H7NO3/c11-6-10-8-3-1-7(2-4-8)5-9(12)13/h1-4H,5H2,(H,12,13) |
InChiKey: | InChIKey=DCFISBPTDDZOQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.