* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1497 |
English Synonyms: | RARECHEM AL BO 1497 |
MDL Number.: | MFCD06208428 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | c1cc(ccc1C(=C(C(=O)O)C(=O)O)C(=O)O)N(CCO)CCO |
InChi: | InChI=1S/C15H17NO8/c17-7-5-16(6-8-18)10-3-1-9(2-4-10)11(13(19)20)12(14(21)22)15(23)24/h1-4,17-18H,5-8H2,(H,19,20)(H,21,22)(H,23,24) |
InChiKey: | InChIKey=BIIKUUWSUIELAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.