* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1504 |
English Synonyms: | RARECHEM AL BO 1504 |
MDL Number.: | MFCD06208430 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C[C@@H](CC(=O)O)c1cn(c2c1cccc2)C |
InChi: | InChI=1S/C13H15NO2/c1-9(7-13(15)16)11-8-14(2)12-6-4-3-5-10(11)12/h3-6,8-9H,7H2,1-2H3,(H,15,16)/t9-/m0/s1 |
InChiKey: | InChIKey=UHAJKLVZQYGGQF-VIFPVBQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.