* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BO 1557 |
| English Synonyms: | RARECHEM AL BO 1557 |
| MDL Number.: | MFCD06208447 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1CC(=O)O)c2csnn2 |
| InChi: | InChI=1S/C10H8N2O2S/c13-10(14)5-7-1-3-8(4-2-7)9-6-15-12-11-9/h1-4,6H,5H2,(H,13,14) |
| InChiKey: | InChIKey=BVELZRKTGZRQLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.