* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BO 1604 |
| English Synonyms: | RARECHEM AL BO 1604 |
| MDL Number.: | MFCD06208471 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1S(=O)(=O)/C(=N/O)/C(=O)O)Cl |
| InChi: | InChI=1S/C8H6ClNO5S/c9-5-1-3-6(4-2-5)16(14,15)7(10-13)8(11)12/h1-4,13H,(H,11,12)/b10-7+ |
| InChiKey: | InChIKey=KVPHRCATKGXTGP-JXMROGBWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.