* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1606 |
English Synonyms: | RARECHEM AL BO 1606 |
MDL Number.: | MFCD06208473 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1ccnc(c1)S(=O)(=O)/C(=N\O)/C(=O)O |
InChi: | InChI=1S/C7H6N2O5S/c10-7(11)6(9-12)15(13,14)5-3-1-2-4-8-5/h1-4,12H,(H,10,11)/b9-6- |
InChiKey: | InChIKey=YBDFEBVYGLBHLL-TWGQIWQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.