* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1706 |
English Synonyms: | RARECHEM AL BO 1706 |
MDL Number.: | MFCD06208528 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1cc(nc(n1)N/C=C(/C(=O)c2ccc(cc2)Cl)\C(=O)O)Cl |
InChi: | InChI=1S/C15H11Cl2N3O3/c1-8-6-12(17)20-15(19-8)18-7-11(14(22)23)13(21)9-2-4-10(16)5-3-9/h2-7H,1H3,(H,22,23)(H,18,19,20)/b11-7- |
InChiKey: | InChIKey=JQNDHFAKHVQOMH-XFFZJAGNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.