* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1710 |
English Synonyms: | RARECHEM AL BO 1710 |
MDL Number.: | MFCD06208532 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1c(cc(c(c1C(=O)O)F)C(=O)O)C(=O)O |
InChi: | InChI=1S/C9H5FO6/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2H,(H,11,12)(H,13,14)(H,15,16) |
InChiKey: | InChIKey=CTBIEMSJCCGWJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.