* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1714 |
English Synonyms: | RARECHEM AL BO 1714 |
MDL Number.: | MFCD06208536 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc(ccc1C/N=C/c2cc(cc(c2O)Cl)Cl)C(=O)O |
InChi: | InChI=1S/C15H11Cl2NO3/c16-12-5-11(14(19)13(17)6-12)8-18-7-9-1-3-10(4-2-9)15(20)21/h1-6,8,19H,7H2,(H,20,21)/b18-8+ |
InChiKey: | InChIKey=JGCURBXROZPPEB-QGMBQPNBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.