* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1735 |
English Synonyms: | RARECHEM AL BO 1735 |
MDL Number.: | MFCD06208547 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCO/C=C(\C(=O)O)/S(=O)(=O)Cc1ccco1 |
InChi: | InChI=1S/C10H12O6S/c1-2-15-6-9(10(11)12)17(13,14)7-8-4-3-5-16-8/h3-6H,2,7H2,1H3,(H,11,12)/b9-6+ |
InChiKey: | InChIKey=ZUENXVBOIBAJFZ-RMKNXTFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.