* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1752 |
English Synonyms: | RARECHEM AL BO 1752 |
MDL Number.: | MFCD06208558 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | COc1ccc(cc1OC)CCNC(=O)C(=O)c2cccn2CCC(=O)O |
InChi: | InChI=1S/C19H22N2O6/c1-26-15-6-5-13(12-16(15)27-2)7-9-20-19(25)18(24)14-4-3-10-21(14)11-8-17(22)23/h3-6,10,12H,7-9,11H2,1-2H3,(H,20,25)(H,22,23) |
InChiKey: | InChIKey=VMJKMWDBWGNTFL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.