* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1756 |
English Synonyms: | RARECHEM AL BO 1756 |
MDL Number.: | MFCD06208560 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | COCCCN/C(=C(/C(=O)N)\C(=O)O)/S |
InChi: | InChI=1S/C8H14N2O4S/c1-14-4-2-3-10-7(15)5(6(9)11)8(12)13/h10,15H,2-4H2,1H3,(H2,9,11)(H,12,13)/b7-5+ |
InChiKey: | InChIKey=SMTBHEVIPFYZGO-FNORWQNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.