* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1760 |
English Synonyms: | RARECHEM AL BO 1760 |
MDL Number.: | MFCD06208562 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C(C(=C(C(=O)O)C(=O)O)N)Cl |
InChi: | InChI=1S/C5H6ClNO4/c6-1-2(7)3(4(8)9)5(10)11/h1,7H2,(H,8,9)(H,10,11) |
InChiKey: | InChIKey=GHMPNCAVMLUWEU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.