* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1761 |
English Synonyms: | RARECHEM AL BO 1761 |
MDL Number.: | MFCD06208563 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1cc(ccc1OCC(=C(C(=O)O)C(=O)O)N)F |
InChi: | InChI=1S/C11H10FNO5/c12-6-1-3-7(4-2-6)18-5-8(13)9(10(14)15)11(16)17/h1-4H,5,13H2,(H,14,15)(H,16,17) |
InChiKey: | InChIKey=RRAMORKAJYQXGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.