* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1771 |
English Synonyms: | RARECHEM AL BO 1771 |
MDL Number.: | MFCD06208569 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1[N+](=O)[O-])/C=C(/C(=O)N)\C(=O)O)Cl |
InChi: | InChI=1S/C10H7ClN2O5/c11-8-2-1-6(13(17)18)3-5(8)4-7(9(12)14)10(15)16/h1-4H,(H2,12,14)(H,15,16)/b7-4- |
InChiKey: | InChIKey=YJNOACNWDCNHEW-DAXSKMNVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.