* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1802 |
English Synonyms: | RARECHEM AL BO 1802 |
MDL Number.: | MFCD06208587 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | Cc1c(c(nc(c1C(=O)O)Cl)N)C(=O)O |
InChi: | InChI=1S/C8H7ClN2O4/c1-2-3(7(12)13)5(9)11-6(10)4(2)8(14)15/h1H3,(H2,10,11)(H,12,13)(H,14,15) |
InChiKey: | InChIKey=LPBJPTZRLJNWAX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.