* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BO 1808 |
| English Synonyms: | RARECHEM AL BO 1808 |
| MDL Number.: | MFCD06208592 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(c1ccc(c(n1)S)C(=O)O)(OC)OC |
| InChi: | InChI=1S/C10H13NO4S/c1-10(14-2,15-3)7-5-4-6(9(12)13)8(16)11-7/h4-5H,1-3H3,(H,11,16)(H,12,13) |
| InChiKey: | InChIKey=OTASXGPFTPHZLJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.