* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BO 1817 |
| English Synonyms: | RARECHEM AL BO 1817 |
| MDL Number.: | MFCD06208597 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1Cn2cnc(c2Cl)Cl)C(=O)O |
| InChi: | InChI=1S/C11H8Cl2N2O2/c12-9-10(13)15(6-14-9)5-7-1-3-8(4-2-7)11(16)17/h1-4,6H,5H2,(H,16,17) |
| InChiKey: | InChIKey=XRPXPAQHCAUWAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.