* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1821 |
English Synonyms: | RARECHEM AL BO 1821 |
MDL Number.: | MFCD06208601 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1cc(c(c(c1)Cl)/C=N/C(=C(\C(=O)O)/NCc2c(nc(s2)Cl)Cl)/C(=O)O)Cl |
InChi: | InChI=1S/C15H9Cl4N3O4S/c16-7-2-1-3-8(17)6(7)4-20-10(13(23)24)11(14(25)26)21-5-9-12(18)22-15(19)27-9/h1-4,21H,5H2,(H,23,24)(H,25,26)/b11-10+,20-4+ |
InChiKey: | InChIKey=FXNAWOWOXJQRLH-YJIYMKLASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.