* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1828 |
English Synonyms: | RARECHEM AL BO 1828 |
MDL Number.: | MFCD06208605 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1ccc2c(c1)C(=O)c3c(ccc(c3C2=O)NC=C(C(=O)O)C(=O)O)N |
InChi: | InChI=1S/C18H12N2O6/c19-11-5-6-12(20-7-10(17(23)24)18(25)26)14-13(11)15(21)8-3-1-2-4-9(8)16(14)22/h1-7,20H,19H2,(H,23,24)(H,25,26) |
InChiKey: | InChIKey=KQRNIIACFWKQRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.