* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1829 |
English Synonyms: | RARECHEM AL BO 1829 |
MDL Number.: | MFCD06208606 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | c1ccc(c(c1)C(=O)N)NC(=C(C(=O)O)C(=O)O)C(=O)O |
InChi: | InChI=1S/C12H10N2O7/c13-9(15)5-3-1-2-4-6(5)14-8(12(20)21)7(10(16)17)11(18)19/h1-4,14H,(H2,13,15)(H,16,17)(H,18,19)(H,20,21) |
InChiKey: | InChIKey=HVNUUBXKFLLGPP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.