* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 0279 |
English Synonyms: | RARECHEM AL BP 0279 |
MDL Number.: | MFCD06209123 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(ccc1C2OCCO2)OC(F)F |
InChi: | InChI=1S/C10H10F2O3/c11-10(12)15-8-3-1-7(2-4-8)9-13-5-6-14-9/h1-4,9-10H,5-6H2 |
InChiKey: | InChIKey=UMWPOSVQAXLMNY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.