* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 0288 |
English Synonyms: | RARECHEM AL BP 0288 |
MDL Number.: | MFCD06209130 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCCc1ccc(cc1)C2OCCO2 |
InChi: | InChI=1S/C13H18O2/c1-2-3-4-11-5-7-12(8-6-11)13-14-9-10-15-13/h5-8,13H,2-4,9-10H2,1H3 |
InChiKey: | InChIKey=MXLCHDPSCBXDKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.