* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 0330 |
English Synonyms: | RARECHEM AL BP 0330 |
MDL Number.: | MFCD06209170 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C[C@H](CCC=C(C)C)CC1OCCO1 |
InChi: | InChI=1S/C12H22O2/c1-10(2)5-4-6-11(3)9-12-13-7-8-14-12/h5,11-12H,4,6-9H2,1-3H3/t11-/m1/s1 |
InChiKey: | InChIKey=KCHXLUDCEMDEFL-LLVKDONJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.