* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 0401 |
English Synonyms: | RARECHEM AL BP 0401 |
MDL Number.: | MFCD06209227 |
H bond acceptor: | 7 |
H bond donor: | 5 |
Smile: | C1COC(O1)[C@H]([C@@H]([C@H]([C@H](CO)O)O)O)O |
InChi: | InChI=1S/C8H16O7/c9-3-4(10)5(11)6(12)7(13)8-14-1-2-15-8/h4-13H,1-3H2/t4-,5-,6+,7-/m0/s1 |
InChiKey: | InChIKey=XKBWYKOTZJRTRK-YTLHQDLWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.