* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 0433 |
English Synonyms: | RARECHEM AL BP 0433 |
MDL Number.: | MFCD06209255 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(ccc1C2OCCO2)OCCO |
InChi: | InChI=1S/C11H14O4/c12-5-6-13-10-3-1-9(2-4-10)11-14-7-8-15-11/h1-4,11-12H,5-8H2 |
InChiKey: | InChIKey=RRLKWKNGGJBBHU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.